C9H11NO4 — CID 174666783
ethyl 4-amino-2,3-dihydroxybenzoate (PubChem CID 174666783) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is ethyl 4-amino-2,3-dihydroxybenzoate.
| Compound Name | ethyl 4-amino-2,3-dihydroxybenzoate |
|---|---|
| PubChem CID | 174666783 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | ethyl 4-amino-2,3-dihydroxybenzoate |
| SMILES | CCOC(=O)c1ccc(N)c(O)c1O |
| InChI | InChI=1S/C9H11NO4/c1-2-14-9(13)5-3-4-6(10)8(12)7(5)11/h3-4,11-12H,2,10H2,1H3 |
| InChIKey | XOZQFJWZVIIHHU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|