C14H27BrN2O5 — CID 174666791
3-bromopropanamide;4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 174666791) has the molecular formula C14H27BrN2O5 and a molecular weight of 383.28 g/mol. Its IUPAC name is 3-bromopropanamide;4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | 3-bromopropanamide;4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 174666791 |
| Molecular Formula | C14H27BrN2O5 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3-bromopropanamide;4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)O.NC(=O)CCBr |
| InChI | InChI=1S/C11H21NO4.C3H6BrNO/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5;4-2-1-3(5)6/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14);1-2H2,(H2,5,6) |
| InChIKey | MKDYZCWVHAJLOL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|