About [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate
[3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate (PubChem CID 174666913) has the molecular formula C10H18FNO3
and a molecular weight of 219.26 g/mol. Its IUPAC name is [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate |
| PubChem CID | 174666913 |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(CO)CC(F)C1 |
| InChI | InChI=1S/C10H18FNO3/c1-9(2,3)12-8(14)15-10(6-13)4-7(11)5-10/h7,13H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | NDOQWSFKRFHGGZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate?
The IUPAC name of [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate (CID 174666913) is [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate.
What is the SMILES notation for [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate?
The canonical SMILES for [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1(CO)CC(F)C1.
What is the InChIKey of [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate?
The InChIKey is NDOQWSFKRFHGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO3/c1-9(2,3)12-8(14)15-10(6-13)4-7(11)5-10/h7,13H,4-6H2,1-3H3,(H,12,14).
What are the key properties of [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate?
[3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate has a molecular weight of 219.26 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-1-(hydroxymethyl)cyclobutyl] N-tert-butylcarbamate is sourced from PubChem (CID 174666913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).