C26H43N3OS — CID 174667689
4-[1-[4-(5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]morpholine (PubChem CID 174667689) has the molecular formula C26H43N3OS and a molecular weight of 445.72 g/mol. Its IUPAC name is 4-[1-[4-(5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]morpholine.
| Compound Name | 4-[1-[4-(5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 174667689 |
| Molecular Formula | C26H43N3OS |
| Molecular Weight | 445.72 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | 4-[1-[4-(5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]morpholine |
| SMILES | CC1(C)CCC(C)(C)C2CC(c3csc(N4CCC(N5CCOCC5)CC4)n3)CCC21 |
| InChI | InChI=1S/C26H43N3OS/c1-25(2)9-10-26(3,4)22-17-19(5-6-21(22)25)23-18-31-24(27-23)29-11-7-20(8-12-29)28-13-15-30-16-14-28/h18-22H,5-17H2,1-4H3 |
| InChIKey | IIYZNUVDCMIRNS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |