About 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane
4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane (PubChem CID 174667825) has the molecular formula C17H28O3S
and a molecular weight of 312.47 g/mol. Its IUPAC name is 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane.
Molecular Properties
| Compound Name | 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane |
| PubChem CID | 174667825 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane |
| SMILES | CCCCCCC.Oc1ccc(SC2COCOC2)cc1 |
| InChI | InChI=1S/C10H12O3S.C7H16/c11-8-1-3-9(4-2-8)14-10-5-12-7-13-6-10;1-3-5-7-6-4-2/h1-4,10-11H,5-7H2;3-7H2,1-2H3 |
| InChIKey | CFDLGQUFHRBCPW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane?
The IUPAC name of 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane (CID 174667825) is 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane.
What is the SMILES notation for 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane?
The canonical SMILES for 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane is CCCCCCC.Oc1ccc(SC2COCOC2)cc1.
What is the InChIKey of 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane?
The InChIKey is CFDLGQUFHRBCPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S.C7H16/c11-8-1-3-9(4-2-8)14-10-5-12-7-13-6-10;1-3-5-7-6-4-2/h1-4,10-11H,5-7H2;3-7H2,1-2H3.
What are the key properties of 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane?
4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane has a molecular weight of 312.47 g/mol, XLogP of 4.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxan-5-ylsulfanyl)phenol;heptane is sourced from PubChem (CID 174667825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).