C11H18N2O3 — CID 174667863
2,6-bis[(hydroxyamino)methyl]-4-propylphenol (PubChem CID 174667863) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,6-bis[(hydroxyamino)methyl]-4-propylphenol.
| Compound Name | 2,6-bis[(hydroxyamino)methyl]-4-propylphenol |
|---|---|
| PubChem CID | 174667863 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2,6-bis[(hydroxyamino)methyl]-4-propylphenol |
| SMILES | CCCc1cc(CNO)c(O)c(CNO)c1 |
| InChI | InChI=1S/C11H18N2O3/c1-2-3-8-4-9(6-12-15)11(14)10(5-8)7-13-16/h4-5,12-16H,2-3,6-7H2,1H3 |
| InChIKey | LRMLVODMIZESGH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|