About (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole
(4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole (PubChem CID 174668146) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 174668146 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCC1=N[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C10H19NO/c1-5-6-9-11-8(7-12-9)10(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | LRVWXMCNMHCSBA-MRVPVSSYSA-N |
| XLogP | 2.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole?
The IUPAC name of (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole (CID 174668146) is (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole is CCCC1=N[C@@H](C(C)(C)C)CO1.
What is the InChIKey of (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole?
The InChIKey is LRVWXMCNMHCSBA-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H19NO/c1-5-6-9-11-8(7-12-9)10(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1.
What are the key properties of (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole?
(4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole has a molecular weight of 169.27 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-tert-butyl-2-propyl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 174668146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).