C15H26O3 — CID 174668266
5-hydroxy-2-methylidenepent-4-enoic acid;1,1,2-trimethylcyclohexane (PubChem CID 174668266) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 5-hydroxy-2-methylidenepent-4-enoic acid;1,1,2-trimethylcyclohexane.
| Compound Name | 5-hydroxy-2-methylidenepent-4-enoic acid;1,1,2-trimethylcyclohexane |
|---|---|
| PubChem CID | 174668266 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 5-hydroxy-2-methylidenepent-4-enoic acid;1,1,2-trimethylcyclohexane |
| SMILES | C=C(CC=CO)C(=O)O.CC1CCCCC1(C)C |
| InChI | InChI=1S/C9H18.C6H8O3/c1-8-6-4-5-7-9(8,2)3;1-5(6(8)9)3-2-4-7/h8H,4-7H2,1-3H3;2,4,7H,1,3H2,(H,8,9) |
| InChIKey | LEDSFVJCRUPDJN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|