About [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate
[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate (PubChem CID 174668304) has the molecular formula C23H22N4O3
and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate.
Molecular Properties
| Compound Name | [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate |
| PubChem CID | 174668304 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate |
| SMILES | Nc1nc(C(=O)N2Cc3ccccc3C2)c2cc(OC(=O)C3CCCC3)ccc2n1 |
| InChI | InChI=1S/C23H22N4O3/c24-23-25-19-10-9-17(30-22(29)14-5-1-2-6-14)11-18(19)20(26-23)21(28)27-12-15-7-3-4-8-16(15)13-27/h3-4,7-11,14H,1-2,5-6,12-13H2,(H2,24,25,26) |
| InChIKey | FTBKTYHCOWAADX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate?
The IUPAC name of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate (CID 174668304) is [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate.
What is the SMILES notation for [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate?
The canonical SMILES for [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate is Nc1nc(C(=O)N2Cc3ccccc3C2)c2cc(OC(=O)C3CCCC3)ccc2n1.
What is the InChIKey of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate?
The InChIKey is FTBKTYHCOWAADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O3/c24-23-25-19-10-9-17(30-22(29)14-5-1-2-6-14)11-18(19)20(26-23)21(28)27-12-15-7-3-4-8-16(15)13-27/h3-4,7-11,14H,1-2,5-6,12-13H2,(H2,24,25,26).
What are the key properties of [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate?
[2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate has a molecular weight of 402.45 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-4-(1,3-dihydroisoindole-2-carbonyl)quinazolin-6-yl] cyclopentanecarboxylate is sourced from PubChem (CID 174668304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).