C24H22Si — CID 174669265
(2,4,5-triphenylcyclopenta-1,4-dien-1-yl)methylsilane (PubChem CID 174669265) has the molecular formula C24H22Si and a molecular weight of 338.53 g/mol. Its IUPAC name is (2,4,5-triphenylcyclopenta-1,4-dien-1-yl)methylsilane.
| Compound Name | (2,4,5-triphenylcyclopenta-1,4-dien-1-yl)methylsilane |
|---|---|
| PubChem CID | 174669265 |
| Molecular Formula | C24H22Si |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2,4,5-triphenylcyclopenta-1,4-dien-1-yl)methylsilane |
| SMILES | [SiH3]CC1=C(c2ccccc2)CC(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C24H22Si/c25-17-23-21(18-10-4-1-5-11-18)16-22(19-12-6-2-7-13-19)24(23)20-14-8-3-9-15-20/h1-15H,16-17H2,25H3 |
| InChIKey | ZWWUCDPBFSTCNY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|