About 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide
4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide (PubChem CID 174669462) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide |
| PubChem CID | 174669462 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide |
| SMILES | CN1C=CNC(=O)C1C(N)=O |
| InChI | InChI=1S/C6H9N3O2/c1-9-3-2-8-6(11)4(9)5(7)10/h2-4H,1H3,(H2,7,10)(H,8,11) |
| InChIKey | YUDFJTGIPPJSCI-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide?
The IUPAC name of 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide (CID 174669462) is 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide.
What is the SMILES notation for 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide?
The canonical SMILES for 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide is CN1C=CNC(=O)C1C(N)=O.
What is the InChIKey of 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide?
The InChIKey is YUDFJTGIPPJSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-9-3-2-8-6(11)4(9)5(7)10/h2-4H,1H3,(H2,7,10)(H,8,11).
What are the key properties of 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide?
4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide has a molecular weight of 155.16 g/mol, XLogP of -1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-oxo-1,3-dihydropyrazine-3-carboxamide is sourced from PubChem (CID 174669462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).