About 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid
2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid (PubChem CID 174670410) has the molecular formula C8H12N4O4S
and a molecular weight of 260.27 g/mol. Its IUPAC name is 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid.
Molecular Properties
| Compound Name | 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid |
| PubChem CID | 174670410 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid |
| SMILES | Nc1nc(N(CCC(N)C(=O)O)C(=O)O)cs1 |
| InChI | InChI=1S/C8H12N4O4S/c9-4(6(13)14)1-2-12(8(15)16)5-3-17-7(10)11-5/h3-4H,1-2,9H2,(H2,10,11)(H,13,14)(H,15,16) |
| InChIKey | IROWOXMYHOBQJW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid?
The IUPAC name of 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid (CID 174670410) is 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid.
What is the SMILES notation for 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid?
The canonical SMILES for 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid is Nc1nc(N(CCC(N)C(=O)O)C(=O)O)cs1.
What is the InChIKey of 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid?
The InChIKey is IROWOXMYHOBQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O4S/c9-4(6(13)14)1-2-12(8(15)16)5-3-17-7(10)11-5/h3-4H,1-2,9H2,(H2,10,11)(H,13,14)(H,15,16).
What are the key properties of 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid?
2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid has a molecular weight of 260.27 g/mol, XLogP of 0.01, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[(2-amino-1,3-thiazol-4-yl)-carboxyamino]butanoic acid is sourced from PubChem (CID 174670410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).