About 4-chloro-5-ethyl-1H-pyrazole;ethyl formate
4-chloro-5-ethyl-1H-pyrazole;ethyl formate (PubChem CID 174670533) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 4-chloro-5-ethyl-1H-pyrazole;ethyl formate.
Molecular Properties
| Compound Name | 4-chloro-5-ethyl-1H-pyrazole;ethyl formate |
| PubChem CID | 174670533 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-chloro-5-ethyl-1H-pyrazole;ethyl formate |
| SMILES | CCOC=O.CCc1[nH]ncc1Cl |
| InChI | InChI=1S/C5H7ClN2.C3H6O2/c1-2-5-4(6)3-7-8-5;1-2-5-3-4/h3H,2H2,1H3,(H,7,8);3H,2H2,1H3 |
| InChIKey | JPSDYNCFRFPAIX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-ethyl-1H-pyrazole;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-ethyl-1H-pyrazole;ethyl formate?
The IUPAC name of 4-chloro-5-ethyl-1H-pyrazole;ethyl formate (CID 174670533) is 4-chloro-5-ethyl-1H-pyrazole;ethyl formate.
What is the SMILES notation for 4-chloro-5-ethyl-1H-pyrazole;ethyl formate?
The canonical SMILES for 4-chloro-5-ethyl-1H-pyrazole;ethyl formate is CCOC=O.CCc1[nH]ncc1Cl.
What is the InChIKey of 4-chloro-5-ethyl-1H-pyrazole;ethyl formate?
The InChIKey is JPSDYNCFRFPAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2.C3H6O2/c1-2-5-4(6)3-7-8-5;1-2-5-3-4/h3H,2H2,1H3,(H,7,8);3H,2H2,1H3.
What are the key properties of 4-chloro-5-ethyl-1H-pyrazole;ethyl formate?
4-chloro-5-ethyl-1H-pyrazole;ethyl formate has a molecular weight of 204.66 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-ethyl-1H-pyrazole;ethyl formate is sourced from PubChem (CID 174670533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).