C18H22BrN3O2 — CID 174671208
tert-butyl 3-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2-iminopentanoate (PubChem CID 174671208) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is tert-butyl 3-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2-iminopentanoate.
| Compound Name | tert-butyl 3-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174671208 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | tert-butyl 3-[5-(4-bromophenyl)-1H-imidazol-2-yl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)C(CC)c1ncc(-c2ccc(Br)cc2)[nH]1 |
| InChI | InChI=1S/C18H22BrN3O2/c1-5-13(15(20)17(23)24-18(2,3)4)16-21-10-14(22-16)11-6-8-12(19)9-7-11/h6-10,13,20H,5H2,1-4H3,(H,21,22)/b20-15- |
| InChIKey | VINZIGVWMBLMIC-HKWRFOASSA-N |
| XLogP | 4.69 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|