About 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid
4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 174671293) has the molecular formula C14H17NO6S2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 174671293 |
| Molecular Formula | C14H17NO6S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | NS(=O)(=O)C1(S(=O)(=O)O)C=CC(c2ccccc2CCO)=CC1 |
| InChI | InChI=1S/C14H17NO6S2/c15-22(17,18)14(23(19,20)21)8-5-12(6-9-14)13-4-2-1-3-11(13)7-10-16/h1-6,8,16H,7,9-10H2,(H2,15,17,18)(H,19,20,21) |
| InChIKey | LOXYPWCQYFOMBZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid (CID 174671293) is 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid is NS(=O)(=O)C1(S(=O)(=O)O)C=CC(c2ccccc2CCO)=CC1.
What is the InChIKey of 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is LOXYPWCQYFOMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO6S2/c15-22(17,18)14(23(19,20)21)8-5-12(6-9-14)13-4-2-1-3-11(13)7-10-16/h1-6,8,16H,7,9-10H2,(H2,15,17,18)(H,19,20,21).
What are the key properties of 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid?
4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 359.43 g/mol, XLogP of 0.44, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-hydroxyethyl)phenyl]-1-sulfamoylcyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 174671293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).