About N-pyridin-3-ylbenzamide;dihydrochloride
N-pyridin-3-ylbenzamide;dihydrochloride (PubChem CID 174671785) has the molecular formula C12H12Cl2N2O
and a molecular weight of 271.15 g/mol. Its IUPAC name is N-pyridin-3-ylbenzamide;dihydrochloride.
Molecular Properties
| Compound Name | N-pyridin-3-ylbenzamide;dihydrochloride |
| PubChem CID | 174671785 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-pyridin-3-ylbenzamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C12H10N2O.2ClH/c15-12(10-5-2-1-3-6-10)14-11-7-4-8-13-9-11;;/h1-9H,(H,14,15);2*1H |
| InChIKey | KDDQKRRTUYMUBG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-pyridin-3-ylbenzamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridin-3-ylbenzamide;dihydrochloride?
The IUPAC name of N-pyridin-3-ylbenzamide;dihydrochloride (CID 174671785) is N-pyridin-3-ylbenzamide;dihydrochloride.
What is the SMILES notation for N-pyridin-3-ylbenzamide;dihydrochloride?
The canonical SMILES for N-pyridin-3-ylbenzamide;dihydrochloride is Cl.Cl.O=C(Nc1cccnc1)c1ccccc1.
What is the InChIKey of N-pyridin-3-ylbenzamide;dihydrochloride?
The InChIKey is KDDQKRRTUYMUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O.2ClH/c15-12(10-5-2-1-3-6-10)14-11-7-4-8-13-9-11;;/h1-9H,(H,14,15);2*1H.
What are the key properties of N-pyridin-3-ylbenzamide;dihydrochloride?
N-pyridin-3-ylbenzamide;dihydrochloride has a molecular weight of 271.15 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridin-3-ylbenzamide;dihydrochloride is sourced from PubChem (CID 174671785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).