About 4-ethenyl-2,3-dimethoxypiperidine
4-ethenyl-2,3-dimethoxypiperidine (PubChem CID 174671886) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-ethenyl-2,3-dimethoxypiperidine.
Molecular Properties
| Compound Name | 4-ethenyl-2,3-dimethoxypiperidine |
| PubChem CID | 174671886 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 4-ethenyl-2,3-dimethoxypiperidine |
| SMILES | C=CC1CCNC(OC)C1OC |
| InChI | InChI=1S/C9H17NO2/c1-4-7-5-6-10-9(12-3)8(7)11-2/h4,7-10H,1,5-6H2,2-3H3 |
| InChIKey | GTLLZCYRROUXKZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-2,3-dimethoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,3-dimethoxypiperidine?
The IUPAC name of 4-ethenyl-2,3-dimethoxypiperidine (CID 174671886) is 4-ethenyl-2,3-dimethoxypiperidine.
What is the SMILES notation for 4-ethenyl-2,3-dimethoxypiperidine?
The canonical SMILES for 4-ethenyl-2,3-dimethoxypiperidine is C=CC1CCNC(OC)C1OC.
What is the InChIKey of 4-ethenyl-2,3-dimethoxypiperidine?
The InChIKey is GTLLZCYRROUXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-7-5-6-10-9(12-3)8(7)11-2/h4,7-10H,1,5-6H2,2-3H3.
What are the key properties of 4-ethenyl-2,3-dimethoxypiperidine?
4-ethenyl-2,3-dimethoxypiperidine has a molecular weight of 171.24 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,3-dimethoxypiperidine is sourced from PubChem (CID 174671886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).