C29H39NO3 — CID 174672494
7-[2-[4-[[3-(2-methoxyethoxy)-4-methylphenyl]methyl]piperidin-1-yl]ethyl]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 174672494) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is 7-[2-[4-[[3-(2-methoxyethoxy)-4-methylphenyl]methyl]piperidin-1-yl]ethyl]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 7-[2-[4-[[3-(2-methoxyethoxy)-4-methylphenyl]methyl]piperidin-1-yl]ethyl]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 174672494 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 7-[2-[4-[[3-(2-methoxyethoxy)-4-methylphenyl]methyl]piperidin-1-yl]ethyl]-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | COCCOc1cc(CC2CCN(CCc3ccc4c(c3)C(C=O)CCC4)CC2)ccc1C |
| InChI | InChI=1S/C29H39NO3/c1-22-6-7-25(20-29(22)33-17-16-32-2)18-24-11-14-30(15-12-24)13-10-23-8-9-26-4-3-5-27(21-31)28(26)19-23/h6-9,19-21,24,27H,3-5,10-18H2,1-2H3 |
| InChIKey | VOJCDCGKBGVQCR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|