C20H22N2O7 — CID 174672586
1-O-[1-(2,6-dimethyl-4-nitrophenyl)-2-oxo-3-pyridinyl] 3-O-ethyl 2-ethylpropanedioate (PubChem CID 174672586) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is 1-O-[1-(2,6-dimethyl-4-nitrophenyl)-2-oxo-3-pyridinyl] 3-O-ethyl 2-ethylpropanedioate.
| Compound Name | 1-O-[1-(2,6-dimethyl-4-nitrophenyl)-2-oxo-3-pyridinyl] 3-O-ethyl 2-ethylpropanedioate |
|---|---|
| PubChem CID | 174672586 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-O-[1-(2,6-dimethyl-4-nitrophenyl)-2-oxo-3-pyridinyl] 3-O-ethyl 2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)C(=O)Oc1cccn(-c2c(C)cc([N+](=O)[O-])cc2C)c1=O |
| InChI | InChI=1S/C20H22N2O7/c1-5-15(19(24)28-6-2)20(25)29-16-8-7-9-21(18(16)23)17-12(3)10-14(22(26)27)11-13(17)4/h7-11,15H,5-6H2,1-4H3 |
| InChIKey | GAFFUNJGBZJFSZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|