C24H29N3O4S — CID 174672949
1-[4-[4-(3,5-dimethylphenyl)piperazine-1-carbonyl]-3-methylsulfonylphenyl]azetidine-2-carbaldehyde (PubChem CID 174672949) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-[4-[4-(3,5-dimethylphenyl)piperazine-1-carbonyl]-3-methylsulfonylphenyl]azetidine-2-carbaldehyde.
| Compound Name | 1-[4-[4-(3,5-dimethylphenyl)piperazine-1-carbonyl]-3-methylsulfonylphenyl]azetidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174672949 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-[4-[4-(3,5-dimethylphenyl)piperazine-1-carbonyl]-3-methylsulfonylphenyl]azetidine-2-carbaldehyde |
| SMILES | Cc1cc(C)cc(N2CCN(C(=O)c3ccc(N4CCC4C=O)cc3S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C24H29N3O4S/c1-17-12-18(2)14-21(13-17)25-8-10-26(11-9-25)24(29)22-5-4-19(15-23(22)32(3,30)31)27-7-6-20(27)16-28/h4-5,12-16,20H,6-11H2,1-3H3 |
| InChIKey | CZGMNIXCSLKAIL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|