About N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane
N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane (PubChem CID 174673437) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane.
Molecular Properties
| Compound Name | N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane |
| PubChem CID | 174673437 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane |
| SMILES | COC.ON=C1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H8ClNO.C2H6O/c10-7-2-3-8-6(5-7)1-4-9(8)11-12;1-3-2/h2-3,5,12H,1,4H2;1-2H3 |
| InChIKey | LOUTTYZZVFYZPJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane?
The IUPAC name of N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane (CID 174673437) is N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane.
What is the SMILES notation for N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane?
The canonical SMILES for N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane is COC.ON=C1CCc2cc(Cl)ccc21.
What is the InChIKey of N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane?
The InChIKey is LOUTTYZZVFYZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO.C2H6O/c10-7-2-3-8-6(5-7)1-4-9(8)11-12;1-3-2/h2-3,5,12H,1,4H2;1-2H3.
What are the key properties of N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane?
N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane has a molecular weight of 227.69 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2,3-dihydroinden-1-ylidene)hydroxylamine;methoxymethane is sourced from PubChem (CID 174673437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).