C16H25BrN4O4 — CID 174674303
ditert-butyl 2-amino-2-[(3-amino-5-bromo-2-pyridinyl)amino]propanedioate (PubChem CID 174674303) has the molecular formula C16H25BrN4O4 and a molecular weight of 417.30 g/mol. Its IUPAC name is ditert-butyl 2-amino-2-[(3-amino-5-bromo-2-pyridinyl)amino]propanedioate.
| Compound Name | ditert-butyl 2-amino-2-[(3-amino-5-bromo-2-pyridinyl)amino]propanedioate |
|---|---|
| PubChem CID | 174674303 |
| Molecular Formula | C16H25BrN4O4 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | ditert-butyl 2-amino-2-[(3-amino-5-bromo-2-pyridinyl)amino]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(Nc1ncc(Br)cc1N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25BrN4O4/c1-14(2,3)24-12(22)16(19,13(23)25-15(4,5)6)21-11-10(18)7-9(17)8-20-11/h7-8H,18-19H2,1-6H3,(H,20,21) |
| InChIKey | CCZNSZJORXGIIN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|