About 1-chloro-2-ethyl-3,4-dimethylcyclobutane
1-chloro-2-ethyl-3,4-dimethylcyclobutane (PubChem CID 174674861) has the molecular formula C8H15Cl
and a molecular weight of 146.66 g/mol. Its IUPAC name is 1-chloro-2-ethyl-3,4-dimethylcyclobutane.
Molecular Properties
| Compound Name | 1-chloro-2-ethyl-3,4-dimethylcyclobutane |
| PubChem CID | 174674861 |
| Molecular Formula | C8H15Cl |
| Molecular Weight | 146.66 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 1-chloro-2-ethyl-3,4-dimethylcyclobutane |
| SMILES | CCC1C(C)C(C)C1Cl |
| InChI | InChI=1S/C8H15Cl/c1-4-7-5(2)6(3)8(7)9/h5-8H,4H2,1-3H3 |
| InChIKey | UWEYLNFCJIZHEE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-ethyl-3,4-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-ethyl-3,4-dimethylcyclobutane?
The IUPAC name of 1-chloro-2-ethyl-3,4-dimethylcyclobutane (CID 174674861) is 1-chloro-2-ethyl-3,4-dimethylcyclobutane.
What is the SMILES notation for 1-chloro-2-ethyl-3,4-dimethylcyclobutane?
The canonical SMILES for 1-chloro-2-ethyl-3,4-dimethylcyclobutane is CCC1C(C)C(C)C1Cl.
What is the InChIKey of 1-chloro-2-ethyl-3,4-dimethylcyclobutane?
The InChIKey is UWEYLNFCJIZHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15Cl/c1-4-7-5(2)6(3)8(7)9/h5-8H,4H2,1-3H3.
What are the key properties of 1-chloro-2-ethyl-3,4-dimethylcyclobutane?
1-chloro-2-ethyl-3,4-dimethylcyclobutane has a molecular weight of 146.66 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-ethyl-3,4-dimethylcyclobutane is sourced from PubChem (CID 174674861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).