C6H12O10 — CID 174675160
cyclohexane-1,1,2,2,3,4,4,5,5,6-decol (PubChem CID 174675160) has the molecular formula C6H12O10 and a molecular weight of 244.15 g/mol. Its IUPAC name is cyclohexane-1,1,2,2,3,4,4,5,5,6-decol.
| Compound Name | cyclohexane-1,1,2,2,3,4,4,5,5,6-decol |
|---|---|
| PubChem CID | 174675160 |
| Molecular Formula | C6H12O10 |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | cyclohexane-1,1,2,2,3,4,4,5,5,6-decol |
| SMILES | OC1C(O)(O)C(O)(O)C(O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C6H12O10/c7-1-3(9,10)5(13,14)2(8)6(15,16)4(1,11)12/h1-2,7-16H |
| InChIKey | GGQZUVZJYHJSRY-UHFFFAOYSA-N |
| XLogP | -6.55 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | -6.55 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|