C22H31N7O4 — CID 174675262
tert-butyl N-[(3R)-1-(7-but-2-ynyl-1-cyano-3,4-dimethyl-2,6-dioxo-5H-purin-8-yl)piperidin-3-yl]carbamate (PubChem CID 174675262) has the molecular formula C22H31N7O4 and a molecular weight of 457.54 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(7-but-2-ynyl-1-cyano-3,4-dimethyl-2,6-dioxo-5H-purin-8-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(7-but-2-ynyl-1-cyano-3,4-dimethyl-2,6-dioxo-5H-purin-8-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 174675262 |
| Molecular Formula | C22H31N7O4 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | tert-butyl N-[(3R)-1-(7-but-2-ynyl-1-cyano-3,4-dimethyl-2,6-dioxo-5H-purin-8-yl)piperidin-3-yl]carbamate |
| SMILES | CC#CCN1C(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)=NC2(C)C1C(=O)N(C#N)C(=O)N2C |
| InChI | InChI=1S/C22H31N7O4/c1-7-8-12-28-16-17(30)29(14-23)20(32)26(6)22(16,5)25-18(28)27-11-9-10-15(13-27)24-19(31)33-21(2,3)4/h15-16H,9-13H2,1-6H3,(H,24,31)/t15-,16?,22?/m1/s1 |
| InChIKey | PLWAAZWQOGCKJK-HOKUHMFPSA-N |
| XLogP | 1.13 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|