About [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate
[2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate (PubChem CID 174676234) has the molecular formula C27H29N3O2
and a molecular weight of 427.55 g/mol. Its IUPAC name is [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate |
| PubChem CID | 174676234 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1cccnc1N1CCN(Cc2ccc3c(c2)Cc2ccccc2-3)CC1 |
| InChI | InChI=1S/C27H29N3O2/c1-19(2)27(31)32-25-8-5-11-28-26(25)30-14-12-29(13-15-30)18-20-9-10-24-22(16-20)17-21-6-3-4-7-23(21)24/h3-11,16,19H,12-15,17-18H2,1-2H3 |
| InChIKey | ZSSORRIWLREKBL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate?
The IUPAC name of [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate (CID 174676234) is [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate.
What is the SMILES notation for [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate?
The canonical SMILES for [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate is CC(C)C(=O)Oc1cccnc1N1CCN(Cc2ccc3c(c2)Cc2ccccc2-3)CC1.
What is the InChIKey of [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate?
The InChIKey is ZSSORRIWLREKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O2/c1-19(2)27(31)32-25-8-5-11-28-26(25)30-14-12-29(13-15-30)18-20-9-10-24-22(16-20)17-21-6-3-4-7-23(21)24/h3-11,16,19H,12-15,17-18H2,1-2H3.
What are the key properties of [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate?
[2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate has a molecular weight of 427.55 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(9H-fluoren-2-ylmethyl)piperazin-1-yl]-3-pyridinyl] 2-methylpropanoate is sourced from PubChem (CID 174676234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).