C16H25N3O2 — CID 174676248
[2-[(3R)-3-(ethylamino)pyrrolidin-1-yl]-4-methyl-3-pyridinyl] 2-methylpropanoate (PubChem CID 174676248) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is [2-[(3R)-3-(ethylamino)pyrrolidin-1-yl]-4-methyl-3-pyridinyl] 2-methylpropanoate.
| Compound Name | [2-[(3R)-3-(ethylamino)pyrrolidin-1-yl]-4-methyl-3-pyridinyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 174676248 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [2-[(3R)-3-(ethylamino)pyrrolidin-1-yl]-4-methyl-3-pyridinyl] 2-methylpropanoate |
| SMILES | CCN[C@@H]1CCN(c2nccc(C)c2OC(=O)C(C)C)C1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-17-13-7-9-19(10-13)15-14(12(4)6-8-18-15)21-16(20)11(2)3/h6,8,11,13,17H,5,7,9-10H2,1-4H3/t13-/m1/s1 |
| InChIKey | JDBVUWHPEHPBRN-CYBMUJFWSA-N |
| XLogP | 2.14 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |