C6H9N2O3+ — CID 174676405
1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydron (PubChem CID 174676405) has the molecular formula C6H9N2O3+ and a molecular weight of 157.15 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydron.
| Compound Name | 1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydron |
|---|---|
| PubChem CID | 174676405 |
| Molecular Formula | C6H9N2O3+ |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 1,3-dimethyl-1,3-diazinane-2,4,6-trione;hydron |
| SMILES | CN1C(=O)CC(=O)N(C)C1=O.[H+] |
| InChI | InChI=1S/C6H8N2O3/c1-7-4(9)3-5(10)8(2)6(7)11/h3H2,1-2H3/p+1 |
| InChIKey | VVSASNKOFCZVES-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|