About 2,3-dimethylquinoline-5,8-diamine
2,3-dimethylquinoline-5,8-diamine (PubChem CID 174677847) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 2,3-dimethylquinoline-5,8-diamine.
Molecular Properties
| Compound Name | 2,3-dimethylquinoline-5,8-diamine |
| PubChem CID | 174677847 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2,3-dimethylquinoline-5,8-diamine |
| SMILES | Cc1cc2c(N)ccc(N)c2nc1C |
| InChI | InChI=1S/C11H13N3/c1-6-5-8-9(12)3-4-10(13)11(8)14-7(6)2/h3-5H,12-13H2,1-2H3 |
| InChIKey | UAXLJMAVUDGJRC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylquinoline-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylquinoline-5,8-diamine?
The IUPAC name of 2,3-dimethylquinoline-5,8-diamine (CID 174677847) is 2,3-dimethylquinoline-5,8-diamine.
What is the SMILES notation for 2,3-dimethylquinoline-5,8-diamine?
The canonical SMILES for 2,3-dimethylquinoline-5,8-diamine is Cc1cc2c(N)ccc(N)c2nc1C.
What is the InChIKey of 2,3-dimethylquinoline-5,8-diamine?
The InChIKey is UAXLJMAVUDGJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-6-5-8-9(12)3-4-10(13)11(8)14-7(6)2/h3-5H,12-13H2,1-2H3.
What are the key properties of 2,3-dimethylquinoline-5,8-diamine?
2,3-dimethylquinoline-5,8-diamine has a molecular weight of 187.25 g/mol, XLogP of 2.02, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylquinoline-5,8-diamine is sourced from PubChem (CID 174677847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).