CH3O5PS — CID 174678304
5-methoxy-5-sulfanylidene-1,2,3,4,5λ5-tetraoxaphospholane (PubChem CID 174678304) has the molecular formula CH3O5PS and a molecular weight of 158.07 g/mol. Its IUPAC name is 5-methoxy-5-sulfanylidene-1,2,3,4,5λ5-tetraoxaphospholane.
| Compound Name | 5-methoxy-5-sulfanylidene-1,2,3,4,5λ5-tetraoxaphospholane |
|---|---|
| PubChem CID | 174678304 |
| Molecular Formula | CH3O5PS |
| Molecular Weight | 158.07 g/mol |
| Exact Mass | 157.94 |
| IUPAC Name | 5-methoxy-5-sulfanylidene-1,2,3,4,5λ5-tetraoxaphospholane |
| SMILES | COP1(=S)OOOO1 |
| InChI | InChI=1S/CH3O5PS/c1-2-7(8)5-3-4-6-7/h1H3 |
| InChIKey | JCMUZIULOKXQGO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.07 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|