C16H27NO4 — CID 174678636
carbamic acid;5-(cyclohexylmethyl)-4,4-dimethyl-2,8-dioxatricyclo[5.1.0.01,3]octane (PubChem CID 174678636) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is carbamic acid;5-(cyclohexylmethyl)-4,4-dimethyl-2,8-dioxatricyclo[5.1.0.01,3]octane.
| Compound Name | carbamic acid;5-(cyclohexylmethyl)-4,4-dimethyl-2,8-dioxatricyclo[5.1.0.01,3]octane |
|---|---|
| PubChem CID | 174678636 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | carbamic acid;5-(cyclohexylmethyl)-4,4-dimethyl-2,8-dioxatricyclo[5.1.0.01,3]octane |
| SMILES | CC1(C)C(CC2CCCCC2)CC2OC23OC13.NC(=O)O |
| InChI | InChI=1S/C15H24O2.CH3NO2/c1-14(2)11(8-10-6-4-3-5-7-10)9-12-15(16-12)13(14)17-15;2-1(3)4/h10-13H,3-9H2,1-2H3;2H2,(H,3,4) |
| InChIKey | JSKPFTZBQYYCOD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|