About 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one
4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one (PubChem CID 174679013) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one.
Molecular Properties
| Compound Name | 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one |
| PubChem CID | 174679013 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one |
| SMILES | CNC1=CCC(CCC(C)=O)(NC)C=C1 |
| InChI | InChI=1S/C12H20N2O/c1-10(15)4-7-12(14-3)8-5-11(13-2)6-9-12/h5-6,8,13-14H,4,7,9H2,1-3H3 |
| InChIKey | AFQKQEKHVSPJSL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one?
The IUPAC name of 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one (CID 174679013) is 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one.
What is the SMILES notation for 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one?
The canonical SMILES for 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one is CNC1=CCC(CCC(C)=O)(NC)C=C1.
What is the InChIKey of 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one?
The InChIKey is AFQKQEKHVSPJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-10(15)4-7-12(14-3)8-5-11(13-2)6-9-12/h5-6,8,13-14H,4,7,9H2,1-3H3.
What are the key properties of 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one?
4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one has a molecular weight of 208.30 g/mol, XLogP of 1.38, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]butan-2-one is sourced from PubChem (CID 174679013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).