About 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide
4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide (PubChem CID 17467918) has the molecular formula C19H27F3N4O2
and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide |
| PubChem CID | 17467918 |
| Molecular Formula | C19H27F3N4O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)CN2CCCC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H27F3N4O2/c1-3-26(4-2)16-9-7-14(8-10-16)18(28)24-23-17(27)13-25-11-5-6-15(12-25)19(20,21)22/h7-10,15H,3-6,11-13H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | JGOIQUKNVGZYDJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide?
The IUPAC name of 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide (CID 17467918) is 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide.
What is the SMILES notation for 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide?
The canonical SMILES for 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide is CCN(CC)c1ccc(C(=O)NNC(=O)CN2CCCC(C(F)(F)F)C2)cc1.
What is the InChIKey of 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide?
The InChIKey is JGOIQUKNVGZYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F3N4O2/c1-3-26(4-2)16-9-7-14(8-10-16)18(28)24-23-17(27)13-25-11-5-6-15(12-25)19(20,21)22/h7-10,15H,3-6,11-13H2,1-2H3,(H,23,27)(H,24,28).
What are the key properties of 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide?
4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide has a molecular weight of 400.45 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)-N'-[2-[3-(trifluoromethyl)piperidin-1-yl]acetyl]benzohydrazide is sourced from PubChem (CID 17467918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).