H14Al2O19P6 — CID 174679314
alumane;[hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174679314) has the molecular formula H14Al2O19P6 and a molecular weight of 557.90 g/mol. Its IUPAC name is alumane;[hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | alumane;[hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174679314 |
| Molecular Formula | H14Al2O19P6 |
| Molecular Weight | 557.90 g/mol |
| Exact Mass | 557.82 |
| IUPAC Name | alumane;[hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O.[AlH3].[AlH3] |
| InChI | InChI=1S/2Al.H8O19P6.6H/c;;1-20(2,3)15-22(7,8)17-24(11,12)19-25(13,14)18-23(9,10)16-21(4,5)6;;;;;;/h;;(H,7,8)(H,9,10)(H,11,12)(H,13,14)(H2,1,2,3)(H2,4,5,6);;;;;; |
| InChIKey | HBJPSMUARYZQKB-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 310.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.90 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|