C11H10FNO6S — CID 174679647
2-(cyclopropylsulfonyloxycarbonylamino)-6-fluorobenzoic acid (PubChem CID 174679647) has the molecular formula C11H10FNO6S and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-(cyclopropylsulfonyloxycarbonylamino)-6-fluorobenzoic acid.
| Compound Name | 2-(cyclopropylsulfonyloxycarbonylamino)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 174679647 |
| Molecular Formula | C11H10FNO6S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-(cyclopropylsulfonyloxycarbonylamino)-6-fluorobenzoic acid |
| SMILES | O=C(Nc1cccc(F)c1C(=O)O)OS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C11H10FNO6S/c12-7-2-1-3-8(9(7)10(14)15)13-11(16)19-20(17,18)6-4-5-6/h1-3,6H,4-5H2,(H,13,16)(H,14,15) |
| InChIKey | INMVTVIAGAHLTA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|