About 1-phenyldibenzothiophene;hydrobromide
1-phenyldibenzothiophene;hydrobromide (PubChem CID 174679709) has the molecular formula C18H13BrS
and a molecular weight of 341.27 g/mol. Its IUPAC name is 1-phenyldibenzothiophene;hydrobromide.
Molecular Properties
| Compound Name | 1-phenyldibenzothiophene;hydrobromide |
| PubChem CID | 174679709 |
| Molecular Formula | C18H13BrS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 1-phenyldibenzothiophene;hydrobromide |
| SMILES | Br.c1ccc(-c2cccc3sc4ccccc4c23)cc1 |
| InChI | InChI=1S/C18H12S.BrH/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17;/h1-12H;1H |
| InChIKey | GURJJFGTKGIENU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenyldibenzothiophene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyldibenzothiophene;hydrobromide?
The IUPAC name of 1-phenyldibenzothiophene;hydrobromide (CID 174679709) is 1-phenyldibenzothiophene;hydrobromide.
What is the SMILES notation for 1-phenyldibenzothiophene;hydrobromide?
The canonical SMILES for 1-phenyldibenzothiophene;hydrobromide is Br.c1ccc(-c2cccc3sc4ccccc4c23)cc1.
What is the InChIKey of 1-phenyldibenzothiophene;hydrobromide?
The InChIKey is GURJJFGTKGIENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12S.BrH/c1-2-7-13(8-3-1)14-10-6-12-17-18(14)15-9-4-5-11-16(15)19-17;/h1-12H;1H.
What are the key properties of 1-phenyldibenzothiophene;hydrobromide?
1-phenyldibenzothiophene;hydrobromide has a molecular weight of 341.27 g/mol, XLogP of 6.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyldibenzothiophene;hydrobromide is sourced from PubChem (CID 174679709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).