About [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine
[3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine (PubChem CID 174679854) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine.
Molecular Properties
| Compound Name | [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine |
| PubChem CID | 174679854 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine |
| SMILES | CCNC.CNC(C)c1cccc(OC=O)c1 |
| InChI | InChI=1S/C10H13NO2.C3H9N/c1-8(11-2)9-4-3-5-10(6-9)13-7-12;1-3-4-2/h3-8,11H,1-2H3;4H,3H2,1-2H3 |
| InChIKey | MJPIBFBEPMOQTP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine?
The IUPAC name of [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine (CID 174679854) is [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine.
What is the SMILES notation for [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine?
The canonical SMILES for [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine is CCNC.CNC(C)c1cccc(OC=O)c1.
What is the InChIKey of [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine?
The InChIKey is MJPIBFBEPMOQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C3H9N/c1-8(11-2)9-4-3-5-10(6-9)13-7-12;1-3-4-2/h3-8,11H,1-2H3;4H,3H2,1-2H3.
What are the key properties of [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine?
[3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine has a molecular weight of 238.33 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-(methylamino)ethyl]phenyl] formate;N-methylethanamine is sourced from PubChem (CID 174679854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).