3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid

C6H8F3NO2 — CID 174680008

IUPAC3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid
SMILESCCNC(=CC(=O)O)C(F)(F)F
InChIInChI=1S/C6H8F3NO2/c1-2-10-4(3-5(11)12)6(7,8)9/h3,10H,2H2,1H3,(H,11,12)
InChIKeyKLUILFXYTDJESI-UHFFFAOYSA-N
MW183.13 g/mol
LogP1.13
Rot. Bonds3

About 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid

3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid (PubChem CID 174680008) has the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. Its IUPAC name is 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid.

Molecular Properties

Compound Name3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid
PubChem CID174680008
Molecular FormulaC6H8F3NO2
Molecular Weight183.13 g/mol
Exact Mass183.05
IUPAC Name3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid
SMILESCCNC(=CC(=O)O)C(F)(F)F
InChIInChI=1S/C6H8F3NO2/c1-2-10-4(3-5(11)12)6(7,8)9/h3,10H,2H2,1H3,(H,11,12)
InChIKeyKLUILFXYTDJESI-UHFFFAOYSA-N
XLogP1.13
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.13
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid?
The IUPAC name of 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid (CID 174680008) is 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid.
What is the SMILES notation for 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid?
The canonical SMILES for 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid is CCNC(=CC(=O)O)C(F)(F)F.
What is the InChIKey of 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid?
The InChIKey is KLUILFXYTDJESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO2/c1-2-10-4(3-5(11)12)6(7,8)9/h3,10H,2H2,1H3,(H,11,12).
What are the key properties of 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid?
3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid has a molecular weight of 183.13 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-4,4,4-trifluorobut-2-enoic acid is sourced from PubChem (CID 174680008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).