C31H26N8O5 — CID 174680199
2,4-bis(2,4-dihydroxyphenyl)-1,5-bis[4-(2H-tetrazol-5-yl)phenyl]pentan-3-one (PubChem CID 174680199) has the molecular formula C31H26N8O5 and a molecular weight of 590.60 g/mol. Its IUPAC name is 2,4-bis(2,4-dihydroxyphenyl)-1,5-bis[4-(2H-tetrazol-5-yl)phenyl]pentan-3-one.
| Compound Name | 2,4-bis(2,4-dihydroxyphenyl)-1,5-bis[4-(2H-tetrazol-5-yl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174680199 |
| Molecular Formula | C31H26N8O5 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2,4-bis(2,4-dihydroxyphenyl)-1,5-bis[4-(2H-tetrazol-5-yl)phenyl]pentan-3-one |
| SMILES | O=C(C(Cc1ccc(-c2nn[nH]n2)cc1)c1ccc(O)cc1O)C(Cc1ccc(-c2nn[nH]n2)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C31H26N8O5/c40-21-9-11-23(27(42)15-21)25(13-17-1-5-19(6-2-17)30-32-36-37-33-30)29(44)26(24-12-10-22(41)16-28(24)43)14-18-3-7-20(8-4-18)31-34-38-39-35-31/h1-12,15-16,25-26,40-43H,13-14H2,(H,32,33,36,37)(H,34,35,38,39) |
| InChIKey | UHLHLCSNTIOOSF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 206.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |