C26H25N5O — CID 174680248
2-amino-3H-pteridin-4-one;1,12-dimethyl-1,2,11,12-tetrahydrochrysene (PubChem CID 174680248) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-amino-3H-pteridin-4-one;1,12-dimethyl-1,2,11,12-tetrahydrochrysene.
| Compound Name | 2-amino-3H-pteridin-4-one;1,12-dimethyl-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174680248 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2-amino-3H-pteridin-4-one;1,12-dimethyl-1,2,11,12-tetrahydrochrysene |
| SMILES | CC1CC=CC2=C1C(C)Cc1c2ccc2ccccc12.Nc1nc2nccnc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H20.C6H5N5O/c1-13-6-5-9-18-17-11-10-15-7-3-4-8-16(15)19(17)12-14(2)20(13)18;7-6-10-4-3(5(12)11-6)8-1-2-9-4/h3-5,7-11,13-14H,6,12H2,1-2H3;1-2H,(H3,7,9,10,11,12) |
| InChIKey | IYDMQQCFUYLPBN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |