C49H38N4O — CID 174680377
2-pentoxy-3,5,10,15-tetraphenylporphyrin (PubChem CID 174680377) has the molecular formula C49H38N4O and a molecular weight of 698.87 g/mol. Its IUPAC name is 2-pentoxy-3,5,10,15-tetraphenylporphyrin.
| Compound Name | 2-pentoxy-3,5,10,15-tetraphenylporphyrin |
|---|---|
| PubChem CID | 174680377 |
| Molecular Formula | C49H38N4O |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | 2-pentoxy-3,5,10,15-tetraphenylporphyrin |
| SMILES | CCCCCOC1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C49H38N4O/c1-2-3-16-31-54-49-43-32-37-25-26-38(50-37)44(33-17-8-4-9-18-33)39-27-28-40(51-39)45(34-19-10-5-11-20-34)41-29-30-42(52-41)46(35-21-12-6-13-22-35)48(53-43)47(49)36-23-14-7-15-24-36/h4-15,17-30,32H,2-3,16,31H2,1H3/b37-32-,43-32-,44-38-,44-39-,45-40-,45-41-,46-42-,48-46- |
| InChIKey | HLXXUNXYIDACAS-XKOMPDDBSA-N |
| XLogP | 11.22 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|