C48H36N4O — CID 174680412
2-butoxy-3,5,10,15-tetraphenylporphyrin (PubChem CID 174680412) has the molecular formula C48H36N4O and a molecular weight of 684.84 g/mol. Its IUPAC name is 2-butoxy-3,5,10,15-tetraphenylporphyrin.
| Compound Name | 2-butoxy-3,5,10,15-tetraphenylporphyrin |
|---|---|
| PubChem CID | 174680412 |
| Molecular Formula | C48H36N4O |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | 2-butoxy-3,5,10,15-tetraphenylporphyrin |
| SMILES | CCCCOC1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C(/c4ccccc4)C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C48H36N4O/c1-2-3-30-53-48-42-31-36-24-25-37(49-36)43(32-16-8-4-9-17-32)38-26-27-39(50-38)44(33-18-10-5-11-19-33)40-28-29-41(51-40)45(34-20-12-6-13-21-34)47(52-42)46(48)35-22-14-7-15-23-35/h4-29,31H,2-3,30H2,1H3/b36-31-,42-31-,43-37-,43-38-,44-39-,44-40-,45-41-,47-45- |
| InChIKey | GFZLFMQYHXXNCD-FLTKUVBLSA-N |
| XLogP | 10.83 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|