About (4-chlorophenyl) 2-phosphanyloctanoate
(4-chlorophenyl) 2-phosphanyloctanoate (PubChem CID 174681070) has the molecular formula C14H20ClO2P
and a molecular weight of 286.74 g/mol. Its IUPAC name is (4-chlorophenyl) 2-phosphanyloctanoate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-phosphanyloctanoate |
| PubChem CID | 174681070 |
| Molecular Formula | C14H20ClO2P |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (4-chlorophenyl) 2-phosphanyloctanoate |
| SMILES | CCCCCCC(P)C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClO2P/c1-2-3-4-5-6-13(18)14(16)17-12-9-7-11(15)8-10-12/h7-10,13H,2-6,18H2,1H3 |
| InChIKey | DWUOSTRDFQEDOX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-phosphanyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-phosphanyloctanoate?
The IUPAC name of (4-chlorophenyl) 2-phosphanyloctanoate (CID 174681070) is (4-chlorophenyl) 2-phosphanyloctanoate.
What is the SMILES notation for (4-chlorophenyl) 2-phosphanyloctanoate?
The canonical SMILES for (4-chlorophenyl) 2-phosphanyloctanoate is CCCCCCC(P)C(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) 2-phosphanyloctanoate?
The InChIKey is DWUOSTRDFQEDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClO2P/c1-2-3-4-5-6-13(18)14(16)17-12-9-7-11(15)8-10-12/h7-10,13H,2-6,18H2,1H3.
What are the key properties of (4-chlorophenyl) 2-phosphanyloctanoate?
(4-chlorophenyl) 2-phosphanyloctanoate has a molecular weight of 286.74 g/mol, XLogP of 4.46, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-phosphanyloctanoate is sourced from PubChem (CID 174681070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).