About acetic acid;ethyl(trioctyl)phosphanium;phosphane
acetic acid;ethyl(trioctyl)phosphanium;phosphane (PubChem CID 174682784) has the molecular formula C28H63O2P2+
and a molecular weight of 493.76 g/mol. Its IUPAC name is acetic acid;ethyl(trioctyl)phosphanium;phosphane.
Molecular Properties
| Compound Name | acetic acid;ethyl(trioctyl)phosphanium;phosphane |
| PubChem CID | 174682784 |
| Molecular Formula | C28H63O2P2+ |
| Molecular Weight | 493.76 g/mol |
| Exact Mass | 493.43 |
| IUPAC Name | acetic acid;ethyl(trioctyl)phosphanium;phosphane |
| SMILES | CC(=O)O.CCCCCCCC[P+](CC)(CCCCCCCC)CCCCCCCC.P |
| InChI | InChI=1S/C26H56P.C2H4O2.H3P/c1-5-9-12-15-18-21-24-27(8-4,25-22-19-16-13-10-6-2)26-23-20-17-14-11-7-3;1-2(3)4;/h5-26H2,1-4H3;1H3,(H,3,4);1H3/q+1;; |
| InChIKey | VGDYTBKZZFLHGN-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.76 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethyl(trioctyl)phosphanium;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl(trioctyl)phosphanium;phosphane?
The IUPAC name of acetic acid;ethyl(trioctyl)phosphanium;phosphane (CID 174682784) is acetic acid;ethyl(trioctyl)phosphanium;phosphane.
What is the SMILES notation for acetic acid;ethyl(trioctyl)phosphanium;phosphane?
The canonical SMILES for acetic acid;ethyl(trioctyl)phosphanium;phosphane is CC(=O)O.CCCCCCCC[P+](CC)(CCCCCCCC)CCCCCCCC.P.
What is the InChIKey of acetic acid;ethyl(trioctyl)phosphanium;phosphane?
The InChIKey is VGDYTBKZZFLHGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H56P.C2H4O2.H3P/c1-5-9-12-15-18-21-24-27(8-4,25-22-19-16-13-10-6-2)26-23-20-17-14-11-7-3;1-2(3)4;/h5-26H2,1-4H3;1H3,(H,3,4);1H3/q+1;;.
What are the key properties of acetic acid;ethyl(trioctyl)phosphanium;phosphane?
acetic acid;ethyl(trioctyl)phosphanium;phosphane has a molecular weight of 493.76 g/mol, XLogP of 10.25, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl(trioctyl)phosphanium;phosphane is sourced from PubChem (CID 174682784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).