C21H18F3N3 — CID 174683484
1H-1,2,4-triazole;9-(trifluoromethyl)-1,2,11,12-tetrahydrochrysene (PubChem CID 174683484) has the molecular formula C21H18F3N3 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1H-1,2,4-triazole;9-(trifluoromethyl)-1,2,11,12-tetrahydrochrysene.
| Compound Name | 1H-1,2,4-triazole;9-(trifluoromethyl)-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174683484 |
| Molecular Formula | C21H18F3N3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1H-1,2,4-triazole;9-(trifluoromethyl)-1,2,11,12-tetrahydrochrysene |
| SMILES | FC(F)(F)c1ccc2ccc3c(c2c1)CCC1=C3C=CCC1.c1nc[nH]n1 |
| InChI | InChI=1S/C19H15F3.C2H3N3/c20-19(21,22)14-8-5-13-7-9-16-15-4-2-1-3-12(15)6-10-17(16)18(13)11-14;1-3-2-5-4-1/h2,4-5,7-9,11H,1,3,6,10H2;1-2H,(H,3,4,5) |
| InChIKey | PUMJUWHXRBWLTD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |