About 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine
1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine (PubChem CID 174683796) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine |
| PubChem CID | 174683796 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine |
| SMILES | Cc1ccc(CC(N)(N)c2ccccc2C)cn1 |
| InChI | InChI=1S/C15H19N3/c1-11-5-3-4-6-14(11)15(16,17)9-13-8-7-12(2)18-10-13/h3-8,10H,9,16-17H2,1-2H3 |
| InChIKey | JBSUUHYTDKQMJV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine?
The IUPAC name of 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine (CID 174683796) is 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine.
What is the SMILES notation for 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine?
The canonical SMILES for 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine is Cc1ccc(CC(N)(N)c2ccccc2C)cn1.
What is the InChIKey of 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine?
The InChIKey is JBSUUHYTDKQMJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-11-5-3-4-6-14(11)15(16,17)9-13-8-7-12(2)18-10-13/h3-8,10H,9,16-17H2,1-2H3.
What are the key properties of 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine?
1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine has a molecular weight of 241.34 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylphenyl)-2-(6-methyl-3-pyridinyl)ethane-1,1-diamine is sourced from PubChem (CID 174683796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).