About 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol
5-methylhex-1-yn-1-ol;pent-1-yn-1-ol (PubChem CID 174684185) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol.
Molecular Properties
| Compound Name | 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol |
| PubChem CID | 174684185 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol |
| SMILES | CC(C)CCC#CO.CCCC#CO |
| InChI | InChI=1S/C7H12O.C5H8O/c1-7(2)5-3-4-6-8;1-2-3-4-5-6/h7-8H,3,5H2,1-2H3;6H,2-3H2,1H3 |
| InChIKey | CUKXRRGGANOPML-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol?
The IUPAC name of 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol (CID 174684185) is 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol.
What is the SMILES notation for 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol?
The canonical SMILES for 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol is CC(C)CCC#CO.CCCC#CO.
What is the InChIKey of 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol?
The InChIKey is CUKXRRGGANOPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C5H8O/c1-7(2)5-3-4-6-8;1-2-3-4-5-6/h7-8H,3,5H2,1-2H3;6H,2-3H2,1H3.
What are the key properties of 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol?
5-methylhex-1-yn-1-ol;pent-1-yn-1-ol has a molecular weight of 196.29 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-1-yn-1-ol;pent-1-yn-1-ol is sourced from PubChem (CID 174684185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).