C13H20N6O3 — CID 174684273
6-amino-9-(azetidin-3-yl)-7H-purin-8-one;tert-butyl formate (PubChem CID 174684273) has the molecular formula C13H20N6O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 6-amino-9-(azetidin-3-yl)-7H-purin-8-one;tert-butyl formate.
| Compound Name | 6-amino-9-(azetidin-3-yl)-7H-purin-8-one;tert-butyl formate |
|---|---|
| PubChem CID | 174684273 |
| Molecular Formula | C13H20N6O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-amino-9-(azetidin-3-yl)-7H-purin-8-one;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.Nc1ncnc2c1[nH]c(=O)n2C1CNC1 |
| InChI | InChI=1S/C8H10N6O.C5H10O2/c9-6-5-7(12-3-11-6)14(8(15)13-5)4-1-10-2-4;1-5(2,3)7-4-6/h3-4,10H,1-2H2,(H,13,15)(H2,9,11,12);4H,1-3H3 |
| InChIKey | XNPVFHDGTFSNCU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|