C19H12O5 — CID 174684586
2-(10,11-dioxonaphtho[1,2-g][1]benzofuran-1-yl)propanoic acid (PubChem CID 174684586) has the molecular formula C19H12O5 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-(10,11-dioxonaphtho[1,2-g][1]benzofuran-1-yl)propanoic acid.
| Compound Name | 2-(10,11-dioxonaphtho[1,2-g][1]benzofuran-1-yl)propanoic acid |
|---|---|
| PubChem CID | 174684586 |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(10,11-dioxonaphtho[1,2-g][1]benzofuran-1-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1coc2c1C(=O)C(=O)c1c-2ccc2ccccc12 |
| InChI | InChI=1S/C19H12O5/c1-9(19(22)23)13-8-24-18-12-7-6-10-4-2-3-5-11(10)14(12)16(20)17(21)15(13)18/h2-9H,1H3,(H,22,23) |
| InChIKey | WGKUYCAKOOJNGM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|