C28H34Cl2N2O6S — CID 174684609
2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[1-(cyclopropylsulfonyloxymethylamino)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid (PubChem CID 174684609) has the molecular formula C28H34Cl2N2O6S and a molecular weight of 597.56 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[1-(cyclopropylsulfonyloxymethylamino)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[1-(cyclopropylsulfonyloxymethylamino)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 174684609 |
| Molecular Formula | C28H34Cl2N2O6S |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[1-(cyclopropylsulfonyloxymethylamino)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
| SMILES | CCC(CNCOS(=O)(=O)C1CC1)N1C(=O)C(C)(CC(=O)O)CC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H34Cl2N2O6S/c1-3-22(16-31-17-38-39(36,37)23-11-12-23)32-26(18-7-9-20(29)10-8-18)24(19-5-4-6-21(30)13-19)14-28(2,27(32)35)15-25(33)34/h4-10,13,22-24,26,31H,3,11-12,14-17H2,1-2H3,(H,33,34) |
| InChIKey | DGTGZBRTFOXZBT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|